C12H24N4O3 — CID 95613270
[(2R)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-1-oxopropan-2-yl]urea (PubChem CID 95613270) has the molecular formula C12H24N4O3 and a molecular weight of 272.35 g/mol. Its IUPAC name is [(2R)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-1-oxopropan-2-yl]urea.
| Compound Name | [(2R)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-1-oxopropan-2-yl]urea |
|---|---|
| PubChem CID | 95613270 |
| Molecular Formula | C12H24N4O3 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.18 |
| IUPAC Name | [(2R)-1-[4-[(2R)-2-hydroxybutyl]piperazin-1-yl]-1-oxopropan-2-yl]urea |
| SMILES | CC[C@@H](O)CN1CCN(C(=O)[C@@H](C)NC(N)=O)CC1 |
| InChI | InChI=1S/C12H24N4O3/c1-3-10(17)8-15-4-6-16(7-5-15)11(18)9(2)14-12(13)19/h9-10,17H,3-8H2,1-2H3,(H3,13,14,19)/t9-,10-/m1/s1 |
| InChIKey | FIBYTTAHEOWWNV-NXEZZACHSA-N |
| XLogP | -1.04 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |