C21H23F3N2O6S — CID 18723095
[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate (PubChem CID 18723095) has the molecular formula C21H23F3N2O6S and a molecular weight of 488.48 g/mol. Its IUPAC name is [4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate.
| Compound Name | [4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate |
|---|---|
| PubChem CID | 18723095 |
| Molecular Formula | C21H23F3N2O6S |
| Molecular Weight | 488.48 g/mol |
| Exact Mass | 488.12 |
| IUPAC Name | [4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate |
| SMILES | CC(C(=O)NO)(c1ccccc1)S(=O)ON1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H23F3N2O6S/c1-20(19(27)25-28,15-5-3-2-4-6-15)33(29)32-26-13-11-17(12-14-26)30-16-7-9-18(10-8-16)31-21(22,23)24/h2-10,17,28H,11-14H2,1H3,(H,25,27) |
| InChIKey | OZXGICWDHOJXHR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.48 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|