C22H25F3N2O4S3 — CID 18723088
[4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate (PubChem CID 18723088) has the molecular formula C22H25F3N2O4S3 and a molecular weight of 534.65 g/mol. Its IUPAC name is [4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate.
| Compound Name | [4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate |
|---|---|
| PubChem CID | 18723088 |
| Molecular Formula | C22H25F3N2O4S3 |
| Molecular Weight | 534.65 g/mol |
| Exact Mass | 534.09 |
| IUPAC Name | [4-[4-(trifluoromethylsulfanyl)phenyl]sulfanylpiperidin-1-yl] 1-(hydroxyamino)-2-methyl-1-oxo-3-phenylpropane-2-sulfinate |
| SMILES | CC(Cc1ccccc1)(C(=O)NO)S(=O)ON1CCC(Sc2ccc(SC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C22H25F3N2O4S3/c1-21(20(28)26-29,15-16-5-3-2-4-6-16)34(30)31-27-13-11-18(12-14-27)32-17-7-9-19(10-8-17)33-22(23,24)25/h2-10,18,29H,11-15H2,1H3,(H,26,28) |
| InChIKey | WAQJKRILCFBLJS-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.65 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|