C23H29F3N2O5S — CID 159079066
ethane;[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate (PubChem CID 159079066) has the molecular formula C23H29F3N2O5S and a molecular weight of 502.56 g/mol. Its IUPAC name is ethane;[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate.
| Compound Name | ethane;[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate |
|---|---|
| PubChem CID | 159079066 |
| Molecular Formula | C23H29F3N2O5S |
| Molecular Weight | 502.56 g/mol |
| Exact Mass | 502.17 |
| IUPAC Name | ethane;[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl] 1-(hydroxyamino)-1-oxo-2-phenylpropane-2-sulfinate |
| SMILES | CC.CC(C(=O)NO)(c1ccccc1)S(=O)ON1CCC(Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C21H23F3N2O5S.C2H6/c1-20(19(27)25-28,15-5-3-2-4-6-15)32(29)31-26-13-11-18(12-14-26)30-17-9-7-16(8-10-17)21(22,23)24;1-2/h2-10,18,28H,11-14H2,1H3,(H,25,27);1-2H3 |
| InChIKey | KAPXTGLNDQFQMD-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.56 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|