C26H32F3N3O5S — CID 139931403
2-[1-benzyl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide (PubChem CID 139931403) has the molecular formula C26H32F3N3O5S and a molecular weight of 555.62 g/mol. Its IUPAC name is 2-[1-benzyl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide.
| Compound Name | 2-[1-benzyl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide |
|---|---|
| PubChem CID | 139931403 |
| Molecular Formula | C26H32F3N3O5S |
| Molecular Weight | 555.62 g/mol |
| Exact Mass | 555.20 |
| IUPAC Name | 2-[1-benzyl-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidin-4-yl]-N-hydroxyacetamide |
| SMILES | O=C(CC1(S(=O)(=O)N2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)CCN(Cc2ccccc2)CC1)NO |
| InChI | InChI=1S/C26H32F3N3O5S/c27-26(28,29)21-6-8-22(9-7-21)37-23-10-14-32(15-11-23)38(35,36)25(18-24(33)30-34)12-16-31(17-13-25)19-20-4-2-1-3-5-20/h1-9,23,34H,10-19H2,(H,30,33) |
| InChIKey | WOUAKAIVEZLCOB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 99.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.62 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|