C25H30ClF3N4O6S — CID 139931376
N-hydroxy-1-[(4-hydroxyphenyl)iminomethyl]-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride (PubChem CID 139931376) has the molecular formula C25H30ClF3N4O6S and a molecular weight of 607.05 g/mol. Its IUPAC name is N-hydroxy-1-[(4-hydroxyphenyl)iminomethyl]-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride.
| Compound Name | N-hydroxy-1-[(4-hydroxyphenyl)iminomethyl]-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 139931376 |
| Molecular Formula | C25H30ClF3N4O6S |
| Molecular Weight | 607.05 g/mol |
| Exact Mass | 606.15 |
| IUPAC Name | N-hydroxy-1-[(4-hydroxyphenyl)iminomethyl]-4-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylpiperidine-4-carboxamide;hydrochloride |
| SMILES | Cl.O=C(NO)C1(S(=O)(=O)N2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)CCN(/C=N/c2ccc(O)cc2)CC1 |
| InChI | InChI=1S/C25H29F3N4O6S.ClH/c26-25(27,28)18-1-7-21(8-2-18)38-22-9-13-32(14-10-22)39(36,37)24(23(34)30-35)11-15-31(16-12-24)17-29-19-3-5-20(33)6-4-19;/h1-8,17,22,33,35H,9-16H2,(H,30,34);1H/b29-17+; |
| InChIKey | LFWSEENDTRLGSA-WDCVSKPTSA-N |
| XLogP | 3.71 |
| TPSA | 131.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.05 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|