C18H19F3N2O5S — CID 160946886
N-hydroxy-2-[3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]sulfonylbenzamide;molecular hydrogen (PubChem CID 160946886) has the molecular formula C18H19F3N2O5S and a molecular weight of 432.42 g/mol. Its IUPAC name is N-hydroxy-2-[3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]sulfonylbenzamide;molecular hydrogen.
| Compound Name | N-hydroxy-2-[3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]sulfonylbenzamide;molecular hydrogen |
|---|---|
| PubChem CID | 160946886 |
| Molecular Formula | C18H19F3N2O5S |
| Molecular Weight | 432.42 g/mol |
| Exact Mass | 432.10 |
| IUPAC Name | N-hydroxy-2-[3-[4-(trifluoromethyl)phenoxy]pyrrolidin-1-yl]sulfonylbenzamide;molecular hydrogen |
| SMILES | O=C(NO)c1ccccc1S(=O)(=O)N1CCC(Oc2ccc(C(F)(F)F)cc2)C1.[H][H] |
| InChI | InChI=1S/C18H17F3N2O5S.H2/c19-18(20,21)12-5-7-13(8-6-12)28-14-9-10-23(11-14)29(26,27)16-4-2-1-3-15(16)17(24)22-25;/h1-8,14,25H,9-11H2,(H,22,24);1H |
| InChIKey | SVFUSQGESWZQBG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 95.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|