C17H18FNO5S2 — CID 154843466
(3S)-3-(4-fluorophenoxy)-1-(2-methylsulfonylphenyl)sulfonylpyrrolidine (PubChem CID 154843466) has the molecular formula C17H18FNO5S2 and a molecular weight of 399.47 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenoxy)-1-(2-methylsulfonylphenyl)sulfonylpyrrolidine.
| Compound Name | (3S)-3-(4-fluorophenoxy)-1-(2-methylsulfonylphenyl)sulfonylpyrrolidine |
|---|---|
| PubChem CID | 154843466 |
| Molecular Formula | C17H18FNO5S2 |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.06 |
| IUPAC Name | (3S)-3-(4-fluorophenoxy)-1-(2-methylsulfonylphenyl)sulfonylpyrrolidine |
| SMILES | CS(=O)(=O)c1ccccc1S(=O)(=O)N1CC[C@H](Oc2ccc(F)cc2)C1 |
| InChI | InChI=1S/C17H18FNO5S2/c1-25(20,21)16-4-2-3-5-17(16)26(22,23)19-11-10-15(12-19)24-14-8-6-13(18)7-9-14/h2-9,15H,10-12H2,1H3/t15-/m0/s1 |
| InChIKey | LTYDFBXHBLKVJL-HNNXBMFYSA-N |
| XLogP | 2.07 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |