C24H29F3N4O6S — CID 20613481
1-N-[2-(dimethylamino)ethyl]-2-N-hydroxy-3-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzene-1,2-dicarboxamide (PubChem CID 20613481) has the molecular formula C24H29F3N4O6S and a molecular weight of 558.58 g/mol. Its IUPAC name is 1-N-[2-(dimethylamino)ethyl]-2-N-hydroxy-3-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzene-1,2-dicarboxamide.
| Compound Name | 1-N-[2-(dimethylamino)ethyl]-2-N-hydroxy-3-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzene-1,2-dicarboxamide |
|---|---|
| PubChem CID | 20613481 |
| Molecular Formula | C24H29F3N4O6S |
| Molecular Weight | 558.58 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 1-N-[2-(dimethylamino)ethyl]-2-N-hydroxy-3-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzene-1,2-dicarboxamide |
| SMILES | CN(C)CCNC(=O)c1cccc(S(=O)(=O)N2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)c1C(=O)NO |
| InChI | InChI=1S/C24H29F3N4O6S/c1-30(2)15-12-28-22(32)19-4-3-5-20(21(19)23(33)29-34)38(35,36)31-13-10-18(11-14-31)37-17-8-6-16(7-9-17)24(25,26)27/h3-9,18,34H,10-15H2,1-2H3,(H,28,32)(H,29,33) |
| InChIKey | XIXDLMWHOAINLW-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 128.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.58 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|