C26H31F3N2O8S — CID 21061219
3-(hydroxymethyl)-2-methoxy-N-(oxan-2-yloxy)-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzamide (PubChem CID 21061219) has the molecular formula C26H31F3N2O8S and a molecular weight of 588.60 g/mol. Its IUPAC name is 3-(hydroxymethyl)-2-methoxy-N-(oxan-2-yloxy)-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzamide.
| Compound Name | 3-(hydroxymethyl)-2-methoxy-N-(oxan-2-yloxy)-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 21061219 |
| Molecular Formula | C26H31F3N2O8S |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 3-(hydroxymethyl)-2-methoxy-N-(oxan-2-yloxy)-6-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfonylbenzamide |
| SMILES | COc1c(CO)ccc(S(=O)(=O)N2CCC(Oc3ccc(C(F)(F)F)cc3)CC2)c1C(=O)NOC1CCCCO1 |
| InChI | InChI=1S/C26H31F3N2O8S/c1-36-24-17(16-32)5-10-21(23(24)25(33)30-39-22-4-2-3-15-37-22)40(34,35)31-13-11-20(12-14-31)38-19-8-6-18(7-9-19)26(27,28)29/h5-10,20,22,32H,2-4,11-16H2,1H3,(H,30,33) |
| InChIKey | FBWHWVPQBXMOCA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|