C24H33N3O4S — CID 142096208
ethane;N-(oxan-2-yloxy)-2-(4-pyridin-4-yloxypiperidin-1-yl)sulfanylbenzamide (PubChem CID 142096208) has the molecular formula C24H33N3O4S and a molecular weight of 459.61 g/mol. Its IUPAC name is ethane;N-(oxan-2-yloxy)-2-(4-pyridin-4-yloxypiperidin-1-yl)sulfanylbenzamide.
| Compound Name | ethane;N-(oxan-2-yloxy)-2-(4-pyridin-4-yloxypiperidin-1-yl)sulfanylbenzamide |
|---|---|
| PubChem CID | 142096208 |
| Molecular Formula | C24H33N3O4S |
| Molecular Weight | 459.61 g/mol |
| Exact Mass | 459.22 |
| IUPAC Name | ethane;N-(oxan-2-yloxy)-2-(4-pyridin-4-yloxypiperidin-1-yl)sulfanylbenzamide |
| SMILES | CC.O=C(NOC1CCCCO1)c1ccccc1SN1CCC(Oc2ccncc2)CC1 |
| InChI | InChI=1S/C22H27N3O4S.C2H6/c26-22(24-29-21-7-3-4-16-27-21)19-5-1-2-6-20(19)30-25-14-10-18(11-15-25)28-17-8-12-23-13-9-17;1-2/h1-2,5-6,8-9,12-13,18,21H,3-4,7,10-11,14-16H2,(H,24,26);1-2H3 |
| InChIKey | XNXKOQCVSPEHSH-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.61 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|