C20H22N2O6S — CID 142028113
2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperidin-1-yl]sulfanylbenzoic acid (PubChem CID 142028113) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is 2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperidin-1-yl]sulfanylbenzoic acid.
| Compound Name | 2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperidin-1-yl]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 142028113 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | 2-(hydroxycarbamoyl)-3-[4-(4-methoxyphenoxy)piperidin-1-yl]sulfanylbenzoic acid |
| SMILES | COc1ccc(OC2CCN(Sc3cccc(C(=O)O)c3C(=O)NO)CC2)cc1 |
| InChI | InChI=1S/C20H22N2O6S/c1-27-13-5-7-14(8-6-13)28-15-9-11-22(12-10-15)29-17-4-2-3-16(20(24)25)18(17)19(23)21-26/h2-8,15,26H,9-12H2,1H3,(H,21,23)(H,24,25) |
| InChIKey | MPFWJVLMVQEDJH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|