C20H20N2O9S — CID 20613423
3-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-2-(hydroxycarbamoyl)benzoic acid (PubChem CID 20613423) has the molecular formula C20H20N2O9S and a molecular weight of 464.45 g/mol. Its IUPAC name is 3-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-2-(hydroxycarbamoyl)benzoic acid.
| Compound Name | 3-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-2-(hydroxycarbamoyl)benzoic acid |
|---|---|
| PubChem CID | 20613423 |
| Molecular Formula | C20H20N2O9S |
| Molecular Weight | 464.45 g/mol |
| Exact Mass | 464.09 |
| IUPAC Name | 3-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-2-(hydroxycarbamoyl)benzoic acid |
| SMILES | O=C(O)c1cccc(S(=O)(=O)N2CCC(Oc3ccc4c(c3)OCO4)CC2)c1C(=O)NO |
| InChI | InChI=1S/C20H20N2O9S/c23-19(21-26)18-14(20(24)25)2-1-3-17(18)32(27,28)22-8-6-12(7-9-22)31-13-4-5-15-16(10-13)30-11-29-15/h1-5,10,12,26H,6-9,11H2,(H,21,23)(H,24,25) |
| InChIKey | HENGRAYQVUBHEW-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 151.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.45 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|