C14H19NO3 — CID 142009570
4-(1,3-benzodioxol-5-yloxy)-1-ethylpiperidine (PubChem CID 142009570) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-(1,3-benzodioxol-5-yloxy)-1-ethylpiperidine.
| Compound Name | 4-(1,3-benzodioxol-5-yloxy)-1-ethylpiperidine |
|---|---|
| PubChem CID | 142009570 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 4-(1,3-benzodioxol-5-yloxy)-1-ethylpiperidine |
| SMILES | CCN1CCC(Oc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C14H19NO3/c1-2-15-7-5-11(6-8-15)18-12-3-4-13-14(9-12)17-10-16-13/h3-4,9,11H,2,5-8,10H2,1H3 |
| InChIKey | WOALHNIKEMDGDG-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |