C12H15NO3 — CID 43211648
2-(1,3-benzodioxol-5-yloxy)cyclopentan-1-amine (PubChem CID 43211648) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)cyclopentan-1-amine.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)cyclopentan-1-amine |
|---|---|
| PubChem CID | 43211648 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)cyclopentan-1-amine |
| SMILES | NC1CCCC1Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C12H15NO3/c13-9-2-1-3-10(9)16-8-4-5-11-12(6-8)15-7-14-11/h4-6,9-10H,1-3,7,13H2 |
| InChIKey | GUQNMNBZNPKTIQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |