C20H18O8 — CID 162998944
5-[[(3R,3aR,6R,6aR)-3-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]oxy]-1,3-benzodioxole (PubChem CID 162998944) has the molecular formula C20H18O8 and a molecular weight of 386.36 g/mol. Its IUPAC name is 5-[[(3R,3aR,6R,6aR)-3-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]oxy]-1,3-benzodioxole.
| Compound Name | 5-[[(3R,3aR,6R,6aR)-3-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]oxy]-1,3-benzodioxole |
|---|---|
| PubChem CID | 162998944 |
| Molecular Formula | C20H18O8 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.10 |
| IUPAC Name | 5-[[(3R,3aR,6R,6aR)-3-(1,3-benzodioxol-5-yloxy)-1,3,3a,4,6,6a-hexahydrofuro[3,4-c]furan-6-yl]oxy]-1,3-benzodioxole |
| SMILES | c1cc2c(cc1O[C@H]1OC[C@@H]3[C@@H](Oc4ccc5c(c4)OCO5)OC[C@H]13)OCO2 |
| InChI | InChI=1S/C20H18O8/c1-3-15-17(25-9-23-15)5-11(1)27-19-13-7-22-20(14(13)8-21-19)28-12-2-4-16-18(6-12)26-10-24-16/h1-6,13-14,19-20H,7-10H2/t13-,14-,19+,20+/m0/s1 |
| InChIKey | XFIZIOXWCHEWOX-AFHBHXEDSA-N |
| XLogP | 2.55 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |