C7H5ClO4P+ — CID 123817005
1,3-benzodioxol-5-yloxy-chloro-oxophosphanium (PubChem CID 123817005) has the molecular formula C7H5ClO4P+ and a molecular weight of 219.54 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yloxy-chloro-oxophosphanium.
| Compound Name | 1,3-benzodioxol-5-yloxy-chloro-oxophosphanium |
|---|---|
| PubChem CID | 123817005 |
| Molecular Formula | C7H5ClO4P+ |
| Molecular Weight | 219.54 g/mol |
| Exact Mass | 218.96 |
| IUPAC Name | 1,3-benzodioxol-5-yloxy-chloro-oxophosphanium |
| SMILES | O=[P+](Cl)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C7H5ClO4P/c8-13(9)12-5-1-2-6-7(3-5)11-4-10-6/h1-3H,4H2/q+1 |
| InChIKey | RDSRHNIQCKHJKO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.54 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|