C14H12ClNO3 — CID 79582670
2-(1,3-benzodioxol-5-yloxymethyl)-4-chloroaniline (PubChem CID 79582670) has the molecular formula C14H12ClNO3 and a molecular weight of 277.71 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxymethyl)-4-chloroaniline.
| Compound Name | 2-(1,3-benzodioxol-5-yloxymethyl)-4-chloroaniline |
|---|---|
| PubChem CID | 79582670 |
| Molecular Formula | C14H12ClNO3 |
| Molecular Weight | 277.71 g/mol |
| Exact Mass | 277.05 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxymethyl)-4-chloroaniline |
| SMILES | Nc1ccc(Cl)cc1COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C14H12ClNO3/c15-10-1-3-12(16)9(5-10)7-17-11-2-4-13-14(6-11)19-8-18-13/h1-6H,7-8,16H2 |
| InChIKey | DLWMULJWTGMOQQ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.71 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|