C11H15NO3 — CID 28917569
1-(1,3-benzodioxol-5-yloxy)-2-methylpropan-2-amine (PubChem CID 28917569) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yloxy)-2-methylpropan-2-amine.
| Compound Name | 1-(1,3-benzodioxol-5-yloxy)-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 28917569 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yloxy)-2-methylpropan-2-amine |
| SMILES | CC(C)(N)COc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15NO3/c1-11(2,12)6-13-8-3-4-9-10(5-8)15-7-14-9/h3-5H,6-7,12H2,1-2H3 |
| InChIKey | GMIYTJMBQNQQQO-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |