C13H19NO4 — CID 82354144
1-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-2-methylpropan-2-amine (PubChem CID 82354144) has the molecular formula C13H19NO4 and a molecular weight of 253.30 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-2-methylpropan-2-amine.
| Compound Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 82354144 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-yloxy)ethoxy]-2-methylpropan-2-amine |
| SMILES | CC(C)(N)COCCOc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H19NO4/c1-13(2,14)8-15-5-6-16-10-3-4-11-12(7-10)18-9-17-11/h3-4,7H,5-6,8-9,14H2,1-2H3 |
| InChIKey | HJVSENDECVYBEQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|