C14H18N2O4 — CID 84755733
2-amino-1-[3-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]ethanone (PubChem CID 84755733) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-amino-1-[3-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]ethanone.
| Compound Name | 2-amino-1-[3-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 84755733 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | 2-amino-1-[3-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]ethanone |
| SMILES | NCC(=O)N1CCCC(Oc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C14H18N2O4/c15-7-14(17)16-5-1-2-11(8-16)20-10-3-4-12-13(6-10)19-9-18-12/h3-4,6,11H,1-2,5,7-9,15H2 |
| InChIKey | CJSYEPGELZOULX-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |