C17H18N2O3 — CID 141132457
2-[(3S)-3-(1,3-benzodioxol-5-yloxy)pyrrolidin-1-yl]aniline (PubChem CID 141132457) has the molecular formula C17H18N2O3 and a molecular weight of 298.34 g/mol. Its IUPAC name is 2-[(3S)-3-(1,3-benzodioxol-5-yloxy)pyrrolidin-1-yl]aniline.
| Compound Name | 2-[(3S)-3-(1,3-benzodioxol-5-yloxy)pyrrolidin-1-yl]aniline |
|---|---|
| PubChem CID | 141132457 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 2-[(3S)-3-(1,3-benzodioxol-5-yloxy)pyrrolidin-1-yl]aniline |
| SMILES | Nc1ccccc1N1CC[C@H](Oc2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C17H18N2O3/c18-14-3-1-2-4-15(14)19-8-7-13(10-19)22-12-5-6-16-17(9-12)21-11-20-16/h1-6,9,13H,7-8,10-11,18H2/t13-/m0/s1 |
| InChIKey | VYBJVVHSCLUBBA-ZDUSSCGKSA-N |
| XLogP | 2.66 |
| TPSA | 56.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|