C13H17NO3 — CID 139709494
1-(1,3-benzodioxol-5-yl)-3-ethoxypyrrolidine (PubChem CID 139709494) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-ethoxypyrrolidine.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-ethoxypyrrolidine |
|---|---|
| PubChem CID | 139709494 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-ethoxypyrrolidine |
| SMILES | CCOC1CCN(c2ccc3c(c2)OCO3)C1 |
| InChI | InChI=1S/C13H17NO3/c1-2-15-11-5-6-14(8-11)10-3-4-12-13(7-10)17-9-16-12/h3-4,7,11H,2,5-6,8-9H2,1H3 |
| InChIKey | CXGWNPJVEKBCQL-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|