C17H16O4 — CID 114518527
1,3-benzodioxol-5-yl-(4-cyclopropyloxyphenyl)methanol (PubChem CID 114518527) has the molecular formula C17H16O4 and a molecular weight of 284.31 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl-(4-cyclopropyloxyphenyl)methanol.
| Compound Name | 1,3-benzodioxol-5-yl-(4-cyclopropyloxyphenyl)methanol |
|---|---|
| PubChem CID | 114518527 |
| Molecular Formula | C17H16O4 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 1,3-benzodioxol-5-yl-(4-cyclopropyloxyphenyl)methanol |
| SMILES | OC(c1ccc(OC2CC2)cc1)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H16O4/c18-17(12-3-8-15-16(9-12)20-10-19-15)11-1-4-13(5-2-11)21-14-6-7-14/h1-5,8-9,14,17-18H,6-7,10H2 |
| InChIKey | JHHLVAJCMWKEHD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |