C17H17FO2 — CID 114518560
(4-cyclopropyloxyphenyl)-(3-fluoro-4-methylphenyl)methanol (PubChem CID 114518560) has the molecular formula C17H17FO2 and a molecular weight of 272.32 g/mol. Its IUPAC name is (4-cyclopropyloxyphenyl)-(3-fluoro-4-methylphenyl)methanol.
| Compound Name | (4-cyclopropyloxyphenyl)-(3-fluoro-4-methylphenyl)methanol |
|---|---|
| PubChem CID | 114518560 |
| Molecular Formula | C17H17FO2 |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.12 |
| IUPAC Name | (4-cyclopropyloxyphenyl)-(3-fluoro-4-methylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2ccc(OC3CC3)cc2)cc1F |
| InChI | InChI=1S/C17H17FO2/c1-11-2-3-13(10-16(11)18)17(19)12-4-6-14(7-5-12)20-15-8-9-15/h2-7,10,15,17,19H,8-9H2,1H3 |
| InChIKey | BITQIAIYQPZNCK-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |