C16H14ClFO2 — CID 114518680
(3-chloro-4-fluorophenyl)-(4-cyclopropyloxyphenyl)methanol (PubChem CID 114518680) has the molecular formula C16H14ClFO2 and a molecular weight of 292.74 g/mol. Its IUPAC name is (3-chloro-4-fluorophenyl)-(4-cyclopropyloxyphenyl)methanol.
| Compound Name | (3-chloro-4-fluorophenyl)-(4-cyclopropyloxyphenyl)methanol |
|---|---|
| PubChem CID | 114518680 |
| Molecular Formula | C16H14ClFO2 |
| Molecular Weight | 292.74 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (3-chloro-4-fluorophenyl)-(4-cyclopropyloxyphenyl)methanol |
| SMILES | OC(c1ccc(OC2CC2)cc1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H14ClFO2/c17-14-9-11(3-8-15(14)18)16(19)10-1-4-12(5-2-10)20-13-6-7-13/h1-5,8-9,13,16,19H,6-7H2 |
| InChIKey | LPVLKLJSKCKODO-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.74 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |