C20H22N2O8S — CID 142028151
N-[[5-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-1,3-benzodioxol-4-yl]methyl]hydroxylamine (PubChem CID 142028151) has the molecular formula C20H22N2O8S and a molecular weight of 450.47 g/mol. Its IUPAC name is N-[[5-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-1,3-benzodioxol-4-yl]methyl]hydroxylamine.
| Compound Name | N-[[5-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-1,3-benzodioxol-4-yl]methyl]hydroxylamine |
|---|---|
| PubChem CID | 142028151 |
| Molecular Formula | C20H22N2O8S |
| Molecular Weight | 450.47 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | N-[[5-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-1,3-benzodioxol-4-yl]methyl]hydroxylamine |
| SMILES | O=S(=O)(c1ccc2c(c1CNO)OCO2)N1CCC(Oc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C20H22N2O8S/c23-21-10-15-19(4-3-17-20(15)29-12-27-17)31(24,25)22-7-5-13(6-8-22)30-14-1-2-16-18(9-14)28-11-26-16/h1-4,9,13,21,23H,5-8,10-12H2 |
| InChIKey | RMZWARKYTKMFDU-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 115.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|