C24H28N2O8S — CID 20613339
2-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-N-(oxan-2-yloxy)benzamide (PubChem CID 20613339) has the molecular formula C24H28N2O8S and a molecular weight of 504.56 g/mol. Its IUPAC name is 2-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-N-(oxan-2-yloxy)benzamide.
| Compound Name | 2-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-N-(oxan-2-yloxy)benzamide |
|---|---|
| PubChem CID | 20613339 |
| Molecular Formula | C24H28N2O8S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 2-[4-(1,3-benzodioxol-5-yloxy)piperidin-1-yl]sulfonyl-N-(oxan-2-yloxy)benzamide |
| SMILES | O=C(NOC1CCCCO1)c1ccccc1S(=O)(=O)N1CCC(Oc2ccc3c(c2)OCO3)CC1 |
| InChI | InChI=1S/C24H28N2O8S/c27-24(25-34-23-7-3-4-14-30-23)19-5-1-2-6-22(19)35(28,29)26-12-10-17(11-13-26)33-18-8-9-20-21(15-18)32-16-31-20/h1-2,5-6,8-9,15,17,23H,3-4,7,10-14,16H2,(H,25,27) |
| InChIKey | MISITTJUOWKANO-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|