C24H27F3N2O5S — CID 142096192
N-(oxan-2-yloxy)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfinylbenzamide (PubChem CID 142096192) has the molecular formula C24H27F3N2O5S and a molecular weight of 512.55 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfinylbenzamide.
| Compound Name | N-(oxan-2-yloxy)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfinylbenzamide |
|---|---|
| PubChem CID | 142096192 |
| Molecular Formula | C24H27F3N2O5S |
| Molecular Weight | 512.55 g/mol |
| Exact Mass | 512.16 |
| IUPAC Name | N-(oxan-2-yloxy)-2-[4-[4-(trifluoromethyl)phenoxy]piperidin-1-yl]sulfinylbenzamide |
| SMILES | O=C(NOC1CCCCO1)c1ccccc1S(=O)N1CCC(Oc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H27F3N2O5S/c25-24(26,27)17-8-10-18(11-9-17)33-19-12-14-29(15-13-19)35(31)21-6-2-1-5-20(21)23(30)28-34-22-7-3-4-16-32-22/h1-2,5-6,8-11,19,22H,3-4,7,12-16H2,(H,28,30) |
| InChIKey | GOAJPQZRQPCKRR-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.55 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|