C25H35F3N2O6S — CID 143045211
N-(oxan-2-yloxy)-4-[4-[[4-(trifluoromethyl)phenyl]methoxymethyl]piperidin-1-yl]sulfinyloxane-4-carboxamide (PubChem CID 143045211) has the molecular formula C25H35F3N2O6S and a molecular weight of 548.62 g/mol. Its IUPAC name is N-(oxan-2-yloxy)-4-[4-[[4-(trifluoromethyl)phenyl]methoxymethyl]piperidin-1-yl]sulfinyloxane-4-carboxamide.
| Compound Name | N-(oxan-2-yloxy)-4-[4-[[4-(trifluoromethyl)phenyl]methoxymethyl]piperidin-1-yl]sulfinyloxane-4-carboxamide |
|---|---|
| PubChem CID | 143045211 |
| Molecular Formula | C25H35F3N2O6S |
| Molecular Weight | 548.62 g/mol |
| Exact Mass | 548.22 |
| IUPAC Name | N-(oxan-2-yloxy)-4-[4-[[4-(trifluoromethyl)phenyl]methoxymethyl]piperidin-1-yl]sulfinyloxane-4-carboxamide |
| SMILES | O=C(NOC1CCCCO1)C1(S(=O)N2CCC(COCc3ccc(C(F)(F)F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C25H35F3N2O6S/c26-25(27,28)21-6-4-19(5-7-21)17-34-18-20-8-12-30(13-9-20)37(32)24(10-15-33-16-11-24)23(31)29-36-22-3-1-2-14-35-22/h4-7,20,22H,1-3,8-18H2,(H,29,31) |
| InChIKey | LQMOCEIZMNCQNJ-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.62 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|