C25H26F3N3O6 — CID 71785004
2-[4-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide;oxalic acid (PubChem CID 71785004) has the molecular formula C25H26F3N3O6 and a molecular weight of 521.49 g/mol. Its IUPAC name is 2-[4-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide;oxalic acid.
| Compound Name | 2-[4-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide;oxalic acid |
|---|---|
| PubChem CID | 71785004 |
| Molecular Formula | C25H26F3N3O6 |
| Molecular Weight | 521.49 g/mol |
| Exact Mass | 521.18 |
| IUPAC Name | 2-[4-[(4-cyanophenyl)methoxymethyl]piperidin-1-yl]-N-[4-(trifluoromethyl)phenyl]acetamide;oxalic acid |
| SMILES | N#Cc1ccc(COCC2CCN(CC(=O)Nc3ccc(C(F)(F)F)cc3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C23H24F3N3O2.C2H2O4/c24-23(25,26)20-5-7-21(8-6-20)28-22(30)14-29-11-9-19(10-12-29)16-31-15-18-3-1-17(13-27)2-4-18;3-1(4)2(5)6/h1-8,19H,9-12,14-16H2,(H,28,30);(H,3,4)(H,5,6) |
| InChIKey | ISHOHAJXDFXPSL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 139.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.49 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|