C22H29N3O7 — CID 71784998
4-[[1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methoxymethyl]benzonitrile;oxalic acid (PubChem CID 71784998) has the molecular formula C22H29N3O7 and a molecular weight of 447.49 g/mol. Its IUPAC name is 4-[[1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methoxymethyl]benzonitrile;oxalic acid.
| Compound Name | 4-[[1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methoxymethyl]benzonitrile;oxalic acid |
|---|---|
| PubChem CID | 71784998 |
| Molecular Formula | C22H29N3O7 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | 4-[[1-(2-morpholin-4-yl-2-oxoethyl)piperidin-4-yl]methoxymethyl]benzonitrile;oxalic acid |
| SMILES | N#Cc1ccc(COCC2CCN(CC(=O)N3CCOCC3)CC2)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C20H27N3O3.C2H2O4/c21-13-17-1-3-18(4-2-17)15-26-16-19-5-7-22(8-6-19)14-20(24)23-9-11-25-12-10-23;3-1(4)2(5)6/h1-4,19H,5-12,14-16H2;(H,3,4)(H,5,6) |
| InChIKey | TXUYILKCRHCFFV-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 140.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|