C21H22F4N2O2 — CID 71784917
4-[(4-fluorophenyl)methoxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide (PubChem CID 71784917) has the molecular formula C21H22F4N2O2 and a molecular weight of 410.41 g/mol. Its IUPAC name is 4-[(4-fluorophenyl)methoxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide.
| Compound Name | 4-[(4-fluorophenyl)methoxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71784917 |
| Molecular Formula | C21H22F4N2O2 |
| Molecular Weight | 410.41 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-[(4-fluorophenyl)methoxymethyl]-N-[4-(trifluoromethyl)phenyl]piperidine-1-carboxamide |
| SMILES | O=C(Nc1ccc(C(F)(F)F)cc1)N1CCC(COCc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C21H22F4N2O2/c22-18-5-1-15(2-6-18)13-29-14-16-9-11-27(12-10-16)20(28)26-19-7-3-17(4-8-19)21(23,24)25/h1-8,16H,9-14H2,(H,26,28) |
| InChIKey | AUUFPUCTVQITOQ-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.41 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |