C26H34FN3O5 — CID 58756740
N-(3,4-dimethoxyphenyl)-4-[3-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]propyl]piperidine-1-carboxamide (PubChem CID 58756740) has the molecular formula C26H34FN3O5 and a molecular weight of 487.57 g/mol. Its IUPAC name is N-(3,4-dimethoxyphenyl)-4-[3-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]propyl]piperidine-1-carboxamide.
| Compound Name | N-(3,4-dimethoxyphenyl)-4-[3-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]propyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 58756740 |
| Molecular Formula | C26H34FN3O5 |
| Molecular Weight | 487.57 g/mol |
| Exact Mass | 487.25 |
| IUPAC Name | N-(3,4-dimethoxyphenyl)-4-[3-[[2-[(4-fluorophenyl)methoxy]acetyl]amino]propyl]piperidine-1-carboxamide |
| SMILES | COc1ccc(NC(=O)N2CCC(CCCNC(=O)COCc3ccc(F)cc3)CC2)cc1OC |
| InChI | InChI=1S/C26H34FN3O5/c1-33-23-10-9-22(16-24(23)34-2)29-26(32)30-14-11-19(12-15-30)4-3-13-28-25(31)18-35-17-20-5-7-21(27)8-6-20/h5-10,16,19H,3-4,11-15,17-18H2,1-2H3,(H,28,31)(H,29,32) |
| InChIKey | NZISECYCXTWWAQ-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.57 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|