C24H30FN3O3 — CID 91903542
N-(3-fluorophenyl)-4-[2-[3-(4-methoxyphenyl)propanoylamino]ethyl]piperidine-1-carboxamide (PubChem CID 91903542) has the molecular formula C24H30FN3O3 and a molecular weight of 427.52 g/mol. Its IUPAC name is N-(3-fluorophenyl)-4-[2-[3-(4-methoxyphenyl)propanoylamino]ethyl]piperidine-1-carboxamide.
| Compound Name | N-(3-fluorophenyl)-4-[2-[3-(4-methoxyphenyl)propanoylamino]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 91903542 |
| Molecular Formula | C24H30FN3O3 |
| Molecular Weight | 427.52 g/mol |
| Exact Mass | 427.23 |
| IUPAC Name | N-(3-fluorophenyl)-4-[2-[3-(4-methoxyphenyl)propanoylamino]ethyl]piperidine-1-carboxamide |
| SMILES | COc1ccc(CCC(=O)NCCC2CCN(C(=O)Nc3cccc(F)c3)CC2)cc1 |
| InChI | InChI=1S/C24H30FN3O3/c1-31-22-8-5-18(6-9-22)7-10-23(29)26-14-11-19-12-15-28(16-13-19)24(30)27-21-4-2-3-20(25)17-21/h2-6,8-9,17,19H,7,10-16H2,1H3,(H,26,29)(H,27,30) |
| InChIKey | ZUQMKBNJESWCJK-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.52 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |