C18H27N3O3 — CID 91913194
4-[2-(3-methoxypropanoylamino)ethyl]-N-phenylpiperidine-1-carboxamide (PubChem CID 91913194) has the molecular formula C18H27N3O3 and a molecular weight of 333.43 g/mol. Its IUPAC name is 4-[2-(3-methoxypropanoylamino)ethyl]-N-phenylpiperidine-1-carboxamide.
| Compound Name | 4-[2-(3-methoxypropanoylamino)ethyl]-N-phenylpiperidine-1-carboxamide |
|---|---|
| PubChem CID | 91913194 |
| Molecular Formula | C18H27N3O3 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.21 |
| IUPAC Name | 4-[2-(3-methoxypropanoylamino)ethyl]-N-phenylpiperidine-1-carboxamide |
| SMILES | COCCC(=O)NCCC1CCN(C(=O)Nc2ccccc2)CC1 |
| InChI | InChI=1S/C18H27N3O3/c1-24-14-10-17(22)19-11-7-15-8-12-21(13-9-15)18(23)20-16-5-3-2-4-6-16/h2-6,15H,7-14H2,1H3,(H,19,22)(H,20,23) |
| InChIKey | LZIWJMICRBIJST-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |