C21H33N3O5 — CID 53057634
4-[2-(butylamino)-2-oxoethyl]-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide (PubChem CID 53057634) has the molecular formula C21H33N3O5 and a molecular weight of 407.51 g/mol. Its IUPAC name is 4-[2-(butylamino)-2-oxoethyl]-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 4-[2-(butylamino)-2-oxoethyl]-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 53057634 |
| Molecular Formula | C21H33N3O5 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 4-[2-(butylamino)-2-oxoethyl]-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide |
| SMILES | CCCCNC(=O)CC1CCN(C(=O)Nc2cc(OC)c(OC)c(OC)c2)CC1 |
| InChI | InChI=1S/C21H33N3O5/c1-5-6-9-22-19(25)12-15-7-10-24(11-8-15)21(26)23-16-13-17(27-2)20(29-4)18(14-16)28-3/h13-15H,5-12H2,1-4H3,(H,22,25)(H,23,26) |
| InChIKey | LBLUGKCZCVGJTG-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|