C19H26N4O4 — CID 90495359
4-(pyrazol-1-ylmethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide (PubChem CID 90495359) has the molecular formula C19H26N4O4 and a molecular weight of 374.44 g/mol. Its IUPAC name is 4-(pyrazol-1-ylmethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide.
| Compound Name | 4-(pyrazol-1-ylmethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 90495359 |
| Molecular Formula | C19H26N4O4 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | 4-(pyrazol-1-ylmethyl)-N-(3,4,5-trimethoxyphenyl)piperidine-1-carboxamide |
| SMILES | COc1cc(NC(=O)N2CCC(Cn3cccn3)CC2)cc(OC)c1OC |
| InChI | InChI=1S/C19H26N4O4/c1-25-16-11-15(12-17(26-2)18(16)27-3)21-19(24)22-9-5-14(6-10-22)13-23-8-4-7-20-23/h4,7-8,11-12,14H,5-6,9-10,13H2,1-3H3,(H,21,24) |
| InChIKey | PRYJDLPXZRBUAU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 77.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |