C17H22N4O — CID 71781180
N-benzyl-4-(pyrazol-1-ylmethyl)piperidine-1-carboxamide (PubChem CID 71781180) has the molecular formula C17H22N4O and a molecular weight of 298.39 g/mol. Its IUPAC name is N-benzyl-4-(pyrazol-1-ylmethyl)piperidine-1-carboxamide.
| Compound Name | N-benzyl-4-(pyrazol-1-ylmethyl)piperidine-1-carboxamide |
|---|---|
| PubChem CID | 71781180 |
| Molecular Formula | C17H22N4O |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | N-benzyl-4-(pyrazol-1-ylmethyl)piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC(Cn2cccn2)CC1 |
| InChI | InChI=1S/C17H22N4O/c22-17(18-13-15-5-2-1-3-6-15)20-11-7-16(8-12-20)14-21-10-4-9-19-21/h1-6,9-10,16H,7-8,11-14H2,(H,18,22) |
| InChIKey | RVYHEMCNQSPQHD-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |