C18H23ClN4O — CID 142636153
N-benzyl-4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxamide (PubChem CID 142636153) has the molecular formula C18H23ClN4O and a molecular weight of 346.86 g/mol. Its IUPAC name is N-benzyl-4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxamide.
| Compound Name | N-benzyl-4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 142636153 |
| Molecular Formula | C18H23ClN4O |
| Molecular Weight | 346.86 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-benzyl-4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC(Cn2cncc2CCl)CC1 |
| InChI | InChI=1S/C18H23ClN4O/c19-10-17-12-20-14-23(17)13-16-6-8-22(9-7-16)18(24)21-11-15-4-2-1-3-5-15/h1-5,12,14,16H,6-11,13H2,(H,21,24) |
| InChIKey | NVGYMSZXEJVVJV-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.86 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|