C18H23Cl2N3O2 — CID 18670921
benzyl 4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxylate;hydrochloride (PubChem CID 18670921) has the molecular formula C18H23Cl2N3O2 and a molecular weight of 384.31 g/mol. Its IUPAC name is benzyl 4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxylate;hydrochloride.
| Compound Name | benzyl 4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxylate;hydrochloride |
|---|---|
| PubChem CID | 18670921 |
| Molecular Formula | C18H23Cl2N3O2 |
| Molecular Weight | 384.31 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | benzyl 4-[[5-(chloromethyl)imidazol-1-yl]methyl]piperidine-1-carboxylate;hydrochloride |
| SMILES | Cl.O=C(OCc1ccccc1)N1CCC(Cn2cncc2CCl)CC1 |
| InChI | InChI=1S/C18H22ClN3O2.ClH/c19-10-17-11-20-14-22(17)12-15-6-8-21(9-7-15)18(23)24-13-16-4-2-1-3-5-16;/h1-5,11,14-15H,6-10,12-13H2;1H |
| InChIKey | GBMYHMYYWOCYDP-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|