C16H20N4O2 — CID 75481460
benzyl 4-(1,2,4-triazol-1-ylmethyl)piperidine-1-carboxylate (PubChem CID 75481460) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is benzyl 4-(1,2,4-triazol-1-ylmethyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-(1,2,4-triazol-1-ylmethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 75481460 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | benzyl 4-(1,2,4-triazol-1-ylmethyl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(Cn2cncn2)CC1 |
| InChI | InChI=1S/C16H20N4O2/c21-16(22-11-15-4-2-1-3-5-15)19-8-6-14(7-9-19)10-20-13-17-12-18-20/h1-5,12-14H,6-11H2 |
| InChIKey | ILDPGXGUZKSYMF-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |