C18H22ClN5O — CID 23577298
N-benzyl-4-[[(3-chloropyrazin-2-yl)amino]methyl]piperidine-1-carboxamide (PubChem CID 23577298) has the molecular formula C18H22ClN5O and a molecular weight of 359.86 g/mol. Its IUPAC name is N-benzyl-4-[[(3-chloropyrazin-2-yl)amino]methyl]piperidine-1-carboxamide.
| Compound Name | N-benzyl-4-[[(3-chloropyrazin-2-yl)amino]methyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 23577298 |
| Molecular Formula | C18H22ClN5O |
| Molecular Weight | 359.86 g/mol |
| Exact Mass | 359.15 |
| IUPAC Name | N-benzyl-4-[[(3-chloropyrazin-2-yl)amino]methyl]piperidine-1-carboxamide |
| SMILES | O=C(NCc1ccccc1)N1CCC(CNc2nccnc2Cl)CC1 |
| InChI | InChI=1S/C18H22ClN5O/c19-16-17(21-9-8-20-16)22-12-15-6-10-24(11-7-15)18(25)23-13-14-4-2-1-3-5-14/h1-5,8-9,15H,6-7,10-13H2,(H,21,22)(H,23,25) |
| InChIKey | ZSPHWEDVYIKZLF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 70.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.86 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |