C26H31F3N2O8S — CID 20613392
2-hydroxy-N-(oxan-2-yloxy)-2-[2-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylphenyl]propanamide (PubChem CID 20613392) has the molecular formula C26H31F3N2O8S and a molecular weight of 588.60 g/mol. Its IUPAC name is 2-hydroxy-N-(oxan-2-yloxy)-2-[2-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylphenyl]propanamide.
| Compound Name | 2-hydroxy-N-(oxan-2-yloxy)-2-[2-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 20613392 |
| Molecular Formula | C26H31F3N2O8S |
| Molecular Weight | 588.60 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 2-hydroxy-N-(oxan-2-yloxy)-2-[2-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylphenyl]propanamide |
| SMILES | CC(O)(C(=O)NOC1CCCCO1)c1ccccc1S(=O)(=O)N1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C26H31F3N2O8S/c1-25(33,24(32)30-39-23-8-4-5-17-36-23)21-6-2-3-7-22(21)40(34,35)31-15-13-19(14-16-31)37-18-9-11-20(12-10-18)38-26(27,28)29/h2-3,6-7,9-12,19,23,33H,4-5,8,13-17H2,1H3,(H,30,32) |
| InChIKey | AXCQUDDZRMVVSL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 123.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.60 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|