C21H26N2O5S — CID 142207087
N,2-dihydroxy-2-[2-[4-(2-methylphenyl)piperidin-1-yl]sulfonylphenyl]propanamide (PubChem CID 142207087) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is N,2-dihydroxy-2-[2-[4-(2-methylphenyl)piperidin-1-yl]sulfonylphenyl]propanamide.
| Compound Name | N,2-dihydroxy-2-[2-[4-(2-methylphenyl)piperidin-1-yl]sulfonylphenyl]propanamide |
|---|---|
| PubChem CID | 142207087 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | N,2-dihydroxy-2-[2-[4-(2-methylphenyl)piperidin-1-yl]sulfonylphenyl]propanamide |
| SMILES | Cc1ccccc1C1CCN(S(=O)(=O)c2ccccc2C(C)(O)C(=O)NO)CC1 |
| InChI | InChI=1S/C21H26N2O5S/c1-15-7-3-4-8-17(15)16-11-13-23(14-12-16)29(27,28)19-10-6-5-9-18(19)21(2,25)20(24)22-26/h3-10,16,25-26H,11-14H2,1-2H3,(H,22,24) |
| InChIKey | QYMOGAGOGIISBW-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|