C20H21F3N2O6S — CID 142207294
N-hydroxy-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonylbenzamide (PubChem CID 142207294) has the molecular formula C20H21F3N2O6S and a molecular weight of 474.46 g/mol. Its IUPAC name is N-hydroxy-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonylbenzamide.
| Compound Name | N-hydroxy-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonylbenzamide |
|---|---|
| PubChem CID | 142207294 |
| Molecular Formula | C20H21F3N2O6S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | N-hydroxy-2-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfonylbenzamide |
| SMILES | O=C(NO)c1ccccc1S(=O)(=O)N1CCC(OCc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H21F3N2O6S/c21-20(22,23)31-16-7-5-14(6-8-16)13-30-15-9-11-25(12-10-15)32(28,29)18-4-2-1-3-17(18)19(26)24-27/h1-8,15,27H,9-13H2,(H,24,26) |
| InChIKey | OUXVFBVDFKGVSO-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|