C21H31F3N2O5S — CID 142009786
ethane;N-hydroxy-4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfanyloxane-4-carboxamide (PubChem CID 142009786) has the molecular formula C21H31F3N2O5S and a molecular weight of 480.55 g/mol. Its IUPAC name is ethane;N-hydroxy-4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfanyloxane-4-carboxamide.
| Compound Name | ethane;N-hydroxy-4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfanyloxane-4-carboxamide |
|---|---|
| PubChem CID | 142009786 |
| Molecular Formula | C21H31F3N2O5S |
| Molecular Weight | 480.55 g/mol |
| Exact Mass | 480.19 |
| IUPAC Name | ethane;N-hydroxy-4-[4-[[4-(trifluoromethoxy)phenyl]methoxy]piperidin-1-yl]sulfanyloxane-4-carboxamide |
| SMILES | CC.O=C(NO)C1(SN2CCC(OCc3ccc(OC(F)(F)F)cc3)CC2)CCOCC1 |
| InChI | InChI=1S/C19H25F3N2O5S.C2H6/c20-19(21,22)29-16-3-1-14(2-4-16)13-28-15-5-9-24(10-6-15)30-18(17(25)23-26)7-11-27-12-8-18;1-2/h1-4,15,26H,5-13H2,(H,23,25);1-2H3 |
| InChIKey | SSZRZTYNJQXJHM-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 80.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|