C21H30F3N3O5S — CID 142009699
N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfanylpiperidine-4-carboxamide (PubChem CID 142009699) has the molecular formula C21H30F3N3O5S and a molecular weight of 493.55 g/mol. Its IUPAC name is N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfanylpiperidine-4-carboxamide.
| Compound Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfanylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 142009699 |
| Molecular Formula | C21H30F3N3O5S |
| Molecular Weight | 493.55 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | N-hydroxy-1-(2-methoxyethyl)-4-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfanylpiperidine-4-carboxamide |
| SMILES | COCCN1CCC(SN2CCC(Oc3ccc(OC(F)(F)F)cc3)CC2)(C(=O)NO)CC1 |
| InChI | InChI=1S/C21H30F3N3O5S/c1-30-15-14-26-12-8-20(9-13-26,19(28)25-29)33-27-10-6-17(7-11-27)31-16-2-4-18(5-3-16)32-21(22,23)24/h2-5,17,29H,6-15H2,1H3,(H,25,28) |
| InChIKey | ATBOEGDBKQROGI-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 83.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.55 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|