C19H21F3N2O7S — CID 142206895
N,2-dihydroxy-6-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexa-1,5-diene-1-carboxamide (PubChem CID 142206895) has the molecular formula C19H21F3N2O7S and a molecular weight of 478.45 g/mol. Its IUPAC name is N,2-dihydroxy-6-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexa-1,5-diene-1-carboxamide.
| Compound Name | N,2-dihydroxy-6-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexa-1,5-diene-1-carboxamide |
|---|---|
| PubChem CID | 142206895 |
| Molecular Formula | C19H21F3N2O7S |
| Molecular Weight | 478.45 g/mol |
| Exact Mass | 478.10 |
| IUPAC Name | N,2-dihydroxy-6-[4-[4-(trifluoromethoxy)phenoxy]piperidin-1-yl]sulfonylcyclohexa-1,5-diene-1-carboxamide |
| SMILES | O=C(NO)C1=C(O)CCC=C1S(=O)(=O)N1CCC(Oc2ccc(OC(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H21F3N2O7S/c20-19(21,22)31-14-6-4-12(5-7-14)30-13-8-10-24(11-9-13)32(28,29)16-3-1-2-15(25)17(16)18(26)23-27/h3-7,13,25,27H,1-2,8-11H2,(H,23,26) |
| InChIKey | SZIMNDVDIMDSIK-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 125.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.45 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|