C16H17F3N4O5S — CID 20613448
N-hydroxy-4-(4-phenoxypiperidin-1-yl)sulfonyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide (PubChem CID 20613448) has the molecular formula C16H17F3N4O5S and a molecular weight of 434.40 g/mol. Its IUPAC name is N-hydroxy-4-(4-phenoxypiperidin-1-yl)sulfonyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide.
| Compound Name | N-hydroxy-4-(4-phenoxypiperidin-1-yl)sulfonyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 20613448 |
| Molecular Formula | C16H17F3N4O5S |
| Molecular Weight | 434.40 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | N-hydroxy-4-(4-phenoxypiperidin-1-yl)sulfonyl-5-(trifluoromethyl)-1H-pyrazole-3-carboxamide |
| SMILES | O=C(NO)c1n[nH]c(C(F)(F)F)c1S(=O)(=O)N1CCC(Oc2ccccc2)CC1 |
| InChI | InChI=1S/C16H17F3N4O5S/c17-16(18,19)14-13(12(20-21-14)15(24)22-25)29(26,27)23-8-6-11(7-9-23)28-10-4-2-1-3-5-10/h1-5,11,25H,6-9H2,(H,20,21)(H,22,24) |
| InChIKey | DZXFEKLDFPALBK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 124.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.40 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|